C12H13FN2O4 — CID 117424010
5-(3-fluoro-2,4,5-trimethoxyphenyl)-1,2-oxazol-3-amine (PubChem CID 117424010) has the molecular formula C12H13FN2O4 and a molecular weight of 268.24 g/mol. Its IUPAC name is 5-(3-fluoro-2,4,5-trimethoxyphenyl)-1,2-oxazol-3-amine.
| Compound Name | 5-(3-fluoro-2,4,5-trimethoxyphenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117424010 |
| Molecular Formula | C12H13FN2O4 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 5-(3-fluoro-2,4,5-trimethoxyphenyl)-1,2-oxazol-3-amine |
| SMILES | COc1cc(-c2cc(N)no2)c(OC)c(F)c1OC |
| InChI | InChI=1S/C12H13FN2O4/c1-16-8-4-6(7-5-9(14)15-19-7)11(17-2)10(13)12(8)18-3/h4-5H,1-3H3,(H2,14,15) |
| InChIKey | IHPITWNDHXZHON-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |