C11H12N2O4S — CID 117424344
3-(2-methoxy-3-methylsulfonylphenyl)-1,2-oxazol-5-amine (PubChem CID 117424344) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is 3-(2-methoxy-3-methylsulfonylphenyl)-1,2-oxazol-5-amine.
| Compound Name | 3-(2-methoxy-3-methylsulfonylphenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117424344 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 3-(2-methoxy-3-methylsulfonylphenyl)-1,2-oxazol-5-amine |
| SMILES | COc1c(-c2cc(N)on2)cccc1S(C)(=O)=O |
| InChI | InChI=1S/C11H12N2O4S/c1-16-11-7(8-6-10(12)17-13-8)4-3-5-9(11)18(2,14)15/h3-6H,12H2,1-2H3 |
| InChIKey | IJDXWXDLMFFDDY-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |