C14H17FO2S — CID 117424743
3-(4-cyclopropylsulfanyl-3-fluorophenyl)-3-methylbutanoic acid (PubChem CID 117424743) has the molecular formula C14H17FO2S and a molecular weight of 268.35 g/mol. Its IUPAC name is 3-(4-cyclopropylsulfanyl-3-fluorophenyl)-3-methylbutanoic acid.
| Compound Name | 3-(4-cyclopropylsulfanyl-3-fluorophenyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 117424743 |
| Molecular Formula | C14H17FO2S |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 3-(4-cyclopropylsulfanyl-3-fluorophenyl)-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)c1ccc(SC2CC2)c(F)c1 |
| InChI | InChI=1S/C14H17FO2S/c1-14(2,8-13(16)17)9-3-6-12(11(15)7-9)18-10-4-5-10/h3,6-7,10H,4-5,8H2,1-2H3,(H,16,17) |
| InChIKey | IMIIHYJQHFNMIN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |