C22H20N2O6 — CID 11742556
(19S)-19-ethyl-10-(213C)ethyl-7,16,19-trihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione (PubChem CID 11742556) has the molecular formula C22H20N2O6 and a molecular weight of 415.36 g/mol. Its IUPAC name is (19S)-19-ethyl-10-(213C)ethyl-7,16,19-trihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione.
| Compound Name | (19S)-19-ethyl-10-(213C)ethyl-7,16,19-trihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 11742556 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (19S)-19-ethyl-10-(213C)ethyl-7,16,19-trihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
| SMILES | CC[C@@]1(O)C(=O)OC(O)c2c1cc1n(c2=O)Cc2c-1n[13c]1[13cH][13cH][13c](O)[13cH][13c]1c2C[13CH3] |
| InChI | InChI=1S/C22H20N2O6/c1-3-11-12-7-10(25)5-6-15(12)23-18-13(11)9-24-16(18)8-14-17(19(24)26)20(27)30-21(28)22(14,29)4-2/h5-8,20,25,27,29H,3-4,9H2,1-2H3/t20?,22-/m0/s1/i1+1,5+1,6+1,7+1,10+1,12+1,15+1 |
| InChIKey | PAPNBDOZIKONPH-LAUFOUPMSA-N |
| XLogP | 1.84 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |