C13H19NO5 — CID 117426318
4-amino-4-(3-ethoxy-5-hydroxy-4-methoxyphenyl)butanoic acid (PubChem CID 117426318) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is 4-amino-4-(3-ethoxy-5-hydroxy-4-methoxyphenyl)butanoic acid.
| Compound Name | 4-amino-4-(3-ethoxy-5-hydroxy-4-methoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 117426318 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 4-amino-4-(3-ethoxy-5-hydroxy-4-methoxyphenyl)butanoic acid |
| SMILES | CCOc1cc(C(N)CCC(=O)O)cc(O)c1OC |
| InChI | InChI=1S/C13H19NO5/c1-3-19-11-7-8(6-10(15)13(11)18-2)9(14)4-5-12(16)17/h6-7,9,15H,3-5,14H2,1-2H3,(H,16,17) |
| InChIKey | KZMBHSUQTBCVAL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |