C13H19NO3S — CID 117426819
2-amino-1-[3-methoxy-2-(thiolan-3-yloxy)phenyl]ethanol (PubChem CID 117426819) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-amino-1-[3-methoxy-2-(thiolan-3-yloxy)phenyl]ethanol.
| Compound Name | 2-amino-1-[3-methoxy-2-(thiolan-3-yloxy)phenyl]ethanol |
|---|---|
| PubChem CID | 117426819 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2-amino-1-[3-methoxy-2-(thiolan-3-yloxy)phenyl]ethanol |
| SMILES | COc1cccc(C(O)CN)c1OC1CCSC1 |
| InChI | InChI=1S/C13H19NO3S/c1-16-12-4-2-3-10(11(15)7-14)13(12)17-9-5-6-18-8-9/h2-4,9,11,15H,5-8,14H2,1H3 |
| InChIKey | SRKVTYDBKHBXAT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |