C24H35NO5 — CID 11742697
7-[(2R)-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-6-oxopiperidin-1-yl]heptanoic acid (PubChem CID 11742697) has the molecular formula C24H35NO5 and a molecular weight of 417.55 g/mol. Its IUPAC name is 7-[(2R)-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-6-oxopiperidin-1-yl]heptanoic acid.
| Compound Name | 7-[(2R)-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-6-oxopiperidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 11742697 |
| Molecular Formula | C24H35NO5 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 7-[(2R)-2-[(E,3S)-3-hydroxy-4-[3-(methoxymethyl)phenyl]but-1-enyl]-6-oxopiperidin-1-yl]heptanoic acid |
| SMILES | COCc1cccc(C[C@H](O)/C=C/[C@H]2CCCC(=O)N2CCCCCCC(=O)O)c1 |
| InChI | InChI=1S/C24H35NO5/c1-30-18-20-9-6-8-19(16-20)17-22(26)14-13-21-10-7-11-23(27)25(21)15-5-3-2-4-12-24(28)29/h6,8-9,13-14,16,21-22,26H,2-5,7,10-12,15,17-18H2,1H3,(H,28,29)/b14-13+/t21-,22-/m1/s1 |
| InChIKey | BCCRAFCMMIFCKU-WRBWEIJPSA-N |
| XLogP | 3.71 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|