C13H16ClNO3 — CID 117427462
1-(4-chloro-7-methoxy-2-methyl-1-benzofuran-5-yl)-2-(methylamino)ethanol (PubChem CID 117427462) has the molecular formula C13H16ClNO3 and a molecular weight of 269.73 g/mol. Its IUPAC name is 1-(4-chloro-7-methoxy-2-methyl-1-benzofuran-5-yl)-2-(methylamino)ethanol.
| Compound Name | 1-(4-chloro-7-methoxy-2-methyl-1-benzofuran-5-yl)-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 117427462 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 1-(4-chloro-7-methoxy-2-methyl-1-benzofuran-5-yl)-2-(methylamino)ethanol |
| SMILES | CNCC(O)c1cc(OC)c2oc(C)cc2c1Cl |
| InChI | InChI=1S/C13H16ClNO3/c1-7-4-9-12(14)8(10(16)6-15-2)5-11(17-3)13(9)18-7/h4-5,10,15-16H,6H2,1-3H3 |
| InChIKey | JRDOZZHFBGIWII-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |