About 4-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-3,5-difluorobenzoic acid
4-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-3,5-difluorobenzoic acid (PubChem CID 117428801) has the molecular formula C13H16F2N2O2
and a molecular weight of 270.28 g/mol. Its IUPAC name is 4-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-3,5-difluorobenzoic acid.
Molecular Properties
| Compound Name | 4-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-3,5-difluorobenzoic acid |
| PubChem CID | 117428801 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 4-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-3,5-difluorobenzoic acid |
| SMILES | CN1CC(CN)CC1c1c(F)cc(C(=O)O)cc1F |
| InChI | InChI=1S/C13H16F2N2O2/c1-17-6-7(5-16)2-11(17)12-9(14)3-8(13(18)19)4-10(12)15/h3-4,7,11H,2,5-6,16H2,1H3,(H,18,19) |
| InChIKey | RHEBQEXLNNPSQC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-3,5-difluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-3,5-difluorobenzoic acid?
The IUPAC name of 4-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-3,5-difluorobenzoic acid (CID 117428801) is 4-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-3,5-difluorobenzoic acid.
What is the SMILES notation for 4-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-3,5-difluorobenzoic acid?
The canonical SMILES for 4-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-3,5-difluorobenzoic acid is CN1CC(CN)CC1c1c(F)cc(C(=O)O)cc1F.
What is the InChIKey of 4-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-3,5-difluorobenzoic acid?
The InChIKey is RHEBQEXLNNPSQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F2N2O2/c1-17-6-7(5-16)2-11(17)12-9(14)3-8(13(18)19)4-10(12)15/h3-4,7,11H,2,5-6,16H2,1H3,(H,18,19).
What are the key properties of 4-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-3,5-difluorobenzoic acid?
4-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-3,5-difluorobenzoic acid has a molecular weight of 270.28 g/mol, XLogP of 1.61, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(aminomethyl)-1-methylpyrrolidin-2-yl]-3,5-difluorobenzoic acid is sourced from PubChem (CID 117428801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).