C15H14N2O3 — CID 117428851
2-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-7-yl)-2-oxoacetic acid (PubChem CID 117428851) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-7-yl)-2-oxoacetic acid.
| Compound Name | 2-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-7-yl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 117428851 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-(9,11-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-7-yl)-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)c1cccc2c3c([nH]c12)N1CCC3CC1 |
| InChI | InChI=1S/C15H14N2O3/c18-13(15(19)20)10-3-1-2-9-11-8-4-6-17(7-5-8)14(11)16-12(9)10/h1-3,8,16H,4-7H2,(H,19,20) |
| InChIKey | WZKDUFLRVMPVFD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|