C17H22N2O — CID 117429365
8-(piperidin-4-ylmethyl)-1,3,4,5-tetrahydropyrano[4,3-b]indole (PubChem CID 117429365) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 8-(piperidin-4-ylmethyl)-1,3,4,5-tetrahydropyrano[4,3-b]indole.
| Compound Name | 8-(piperidin-4-ylmethyl)-1,3,4,5-tetrahydropyrano[4,3-b]indole |
|---|---|
| PubChem CID | 117429365 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 8-(piperidin-4-ylmethyl)-1,3,4,5-tetrahydropyrano[4,3-b]indole |
| SMILES | c1cc2[nH]c3c(c2cc1CC1CCNCC1)COCC3 |
| InChI | InChI=1S/C17H22N2O/c1-2-16-14(15-11-20-8-5-17(15)19-16)10-13(1)9-12-3-6-18-7-4-12/h1-2,10,12,18-19H,3-9,11H2 |
| InChIKey | DYAQHFUGMVHGTJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|