About 4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-piperazin-1-ylmethyl]-N,N-diethylbenzamide
4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-piperazin-1-ylmethyl]-N,N-diethylbenzamide (PubChem CID 11742939) has the molecular formula C26H35N3O2
and a molecular weight of 421.59 g/mol. Its IUPAC name is 4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-piperazin-1-ylmethyl]-N,N-diethylbenzamide.
Molecular Properties
| Compound Name | 4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-piperazin-1-ylmethyl]-N,N-diethylbenzamide |
| PubChem CID | 11742939 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-piperazin-1-ylmethyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(c2cccc3c2OC(C)(C)C3)N2CCNCC2)cc1 |
| InChI | InChI=1S/C26H35N3O2/c1-5-28(6-2)25(30)20-12-10-19(11-13-20)23(29-16-14-27-15-17-29)22-9-7-8-21-18-26(3,4)31-24(21)22/h7-13,23,27H,5-6,14-18H2,1-4H3 |
| InChIKey | JADQIZMTGFFEHQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-piperazin-1-ylmethyl]-N,N-diethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-piperazin-1-ylmethyl]-N,N-diethylbenzamide?
The IUPAC name of 4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-piperazin-1-ylmethyl]-N,N-diethylbenzamide (CID 11742939) is 4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-piperazin-1-ylmethyl]-N,N-diethylbenzamide.
What is the SMILES notation for 4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-piperazin-1-ylmethyl]-N,N-diethylbenzamide?
The canonical SMILES for 4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-piperazin-1-ylmethyl]-N,N-diethylbenzamide is CCN(CC)C(=O)c1ccc(C(c2cccc3c2OC(C)(C)C3)N2CCNCC2)cc1.
What is the InChIKey of 4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-piperazin-1-ylmethyl]-N,N-diethylbenzamide?
The InChIKey is JADQIZMTGFFEHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H35N3O2/c1-5-28(6-2)25(30)20-12-10-19(11-13-20)23(29-16-14-27-15-17-29)22-9-7-8-21-18-26(3,4)31-24(21)22/h7-13,23,27H,5-6,14-18H2,1-4H3.
What are the key properties of 4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-piperazin-1-ylmethyl]-N,N-diethylbenzamide?
4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-piperazin-1-ylmethyl]-N,N-diethylbenzamide has a molecular weight of 421.59 g/mol, XLogP of 3.88, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,2-dimethyl-3H-1-benzofuran-7-yl)-piperazin-1-ylmethyl]-N,N-diethylbenzamide is sourced from PubChem (CID 11742939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).