C22H30O6S — CID 11742987
[(2R,3S,4R,6S)-3-acetyloxy-6-ethoxy-2-[(E)-4-phenylsulfanylbut-2-enyl]oxan-4-yl]methyl acetate (PubChem CID 11742987) has the molecular formula C22H30O6S and a molecular weight of 422.54 g/mol. Its IUPAC name is [(2R,3S,4R,6S)-3-acetyloxy-6-ethoxy-2-[(E)-4-phenylsulfanylbut-2-enyl]oxan-4-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,6S)-3-acetyloxy-6-ethoxy-2-[(E)-4-phenylsulfanylbut-2-enyl]oxan-4-yl]methyl acetate |
|---|---|
| PubChem CID | 11742987 |
| Molecular Formula | C22H30O6S |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [(2R,3S,4R,6S)-3-acetyloxy-6-ethoxy-2-[(E)-4-phenylsulfanylbut-2-enyl]oxan-4-yl]methyl acetate |
| SMILES | CCO[C@@H]1C[C@H](COC(C)=O)[C@H](OC(C)=O)[C@@H](C/C=C/CSc2ccccc2)O1 |
| InChI | InChI=1S/C22H30O6S/c1-4-25-21-14-18(15-26-16(2)23)22(27-17(3)24)20(28-21)12-8-9-13-29-19-10-6-5-7-11-19/h5-11,18,20-22H,4,12-15H2,1-3H3/b9-8+/t18-,20-,21+,22+/m1/s1 |
| InChIKey | YWJAPXRPFWRQQK-FFJBZRJHSA-N |
| XLogP | 3.99 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|