C13H13N5O2 — CID 117430777
1-[3-(3-amino-1H-pyrazol-5-yl)phenyl]piperazine-2,3-dione (PubChem CID 117430777) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 1-[3-(3-amino-1H-pyrazol-5-yl)phenyl]piperazine-2,3-dione.
| Compound Name | 1-[3-(3-amino-1H-pyrazol-5-yl)phenyl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 117430777 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 1-[3-(3-amino-1H-pyrazol-5-yl)phenyl]piperazine-2,3-dione |
| SMILES | Nc1cc(-c2cccc(N3CCNC(=O)C3=O)c2)[nH]n1 |
| InChI | InChI=1S/C13H13N5O2/c14-11-7-10(16-17-11)8-2-1-3-9(6-8)18-5-4-15-12(19)13(18)20/h1-3,6-7H,4-5H2,(H,15,19)(H3,14,16,17) |
| InChIKey | WSPVSUMNBRXGJG-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|