C16H21N3O — CID 117431573
5-[2-(1-methylazepan-4-yl)phenyl]-1,2-oxazol-3-amine (PubChem CID 117431573) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 5-[2-(1-methylazepan-4-yl)phenyl]-1,2-oxazol-3-amine.
| Compound Name | 5-[2-(1-methylazepan-4-yl)phenyl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117431573 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 5-[2-(1-methylazepan-4-yl)phenyl]-1,2-oxazol-3-amine |
| SMILES | CN1CCCC(c2ccccc2-c2cc(N)no2)CC1 |
| InChI | InChI=1S/C16H21N3O/c1-19-9-4-5-12(8-10-19)13-6-2-3-7-14(13)15-11-16(17)18-20-15/h2-3,6-7,11-12H,4-5,8-10H2,1H3,(H2,17,18) |
| InChIKey | OVVDUZBPDDCNBN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |