C13H17FO5 — CID 117433339
ethyl 2-[5-fluoro-4-methoxy-2-(methoxymethyl)phenyl]-2-hydroxyacetate (PubChem CID 117433339) has the molecular formula C13H17FO5 and a molecular weight of 272.27 g/mol. Its IUPAC name is ethyl 2-[5-fluoro-4-methoxy-2-(methoxymethyl)phenyl]-2-hydroxyacetate.
| Compound Name | ethyl 2-[5-fluoro-4-methoxy-2-(methoxymethyl)phenyl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 117433339 |
| Molecular Formula | C13H17FO5 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | ethyl 2-[5-fluoro-4-methoxy-2-(methoxymethyl)phenyl]-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)c1cc(F)c(OC)cc1COC |
| InChI | InChI=1S/C13H17FO5/c1-4-19-13(16)12(15)9-6-10(14)11(18-3)5-8(9)7-17-2/h5-6,12,15H,4,7H2,1-3H3 |
| InChIKey | OXSDNPQWXLNPKK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |