C23H27NO5S — CID 11743380
(4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)-1-(4-methylsulfonylphenyl)pyrrolidin-2-one (PubChem CID 11743380) has the molecular formula C23H27NO5S and a molecular weight of 429.54 g/mol. Its IUPAC name is (4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)-1-(4-methylsulfonylphenyl)pyrrolidin-2-one.
| Compound Name | (4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)-1-(4-methylsulfonylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 11743380 |
| Molecular Formula | C23H27NO5S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (4R)-4-(3-cyclopentyloxy-4-methoxyphenyl)-1-(4-methylsulfonylphenyl)pyrrolidin-2-one |
| SMILES | COc1ccc([C@H]2CC(=O)N(c3ccc(S(C)(=O)=O)cc3)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C23H27NO5S/c1-28-21-12-7-16(13-22(21)29-19-5-3-4-6-19)17-14-23(25)24(15-17)18-8-10-20(11-9-18)30(2,26)27/h7-13,17,19H,3-6,14-15H2,1-2H3/t17-/m0/s1 |
| InChIKey | GZCVMXHJFSMVTL-KRWDZBQOSA-N |
| XLogP | 3.94 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |