C18H24O2 — CID 117434022
2-[1-[3-(4-methylcyclohexyl)phenyl]cyclopropyl]acetic acid (PubChem CID 117434022) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-[1-[3-(4-methylcyclohexyl)phenyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[3-(4-methylcyclohexyl)phenyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 117434022 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 2-[1-[3-(4-methylcyclohexyl)phenyl]cyclopropyl]acetic acid |
| SMILES | CC1CCC(c2cccc(C3(CC(=O)O)CC3)c2)CC1 |
| InChI | InChI=1S/C18H24O2/c1-13-5-7-14(8-6-13)15-3-2-4-16(11-15)18(9-10-18)12-17(19)20/h2-4,11,13-14H,5-10,12H2,1H3,(H,19,20) |
| InChIKey | ZZYFKCKVFWJJEC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |