About 2-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-N-methylethanamine
2-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-N-methylethanamine (PubChem CID 117435826) has the molecular formula C16H19NO3
and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-N-methylethanamine.
Molecular Properties
| Compound Name | 2-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-N-methylethanamine |
| PubChem CID | 117435826 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 2-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-N-methylethanamine |
| SMILES | CNCCc1c2cc(C)oc2c(OC)c2cc(C)oc12 |
| InChI | InChI=1S/C16H19NO3/c1-9-7-12-11(5-6-17-3)14-13(8-10(2)19-14)15(18-4)16(12)20-9/h7-8,17H,5-6H2,1-4H3 |
| InChIKey | PSKNKEHJCUMWHZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 47.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-N-methylethanamine?
The IUPAC name of 2-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-N-methylethanamine (CID 117435826) is 2-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-N-methylethanamine.
What is the SMILES notation for 2-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-N-methylethanamine?
The canonical SMILES for 2-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-N-methylethanamine is CNCCc1c2cc(C)oc2c(OC)c2cc(C)oc12.
What is the InChIKey of 2-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-N-methylethanamine?
The InChIKey is PSKNKEHJCUMWHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO3/c1-9-7-12-11(5-6-17-3)14-13(8-10(2)19-14)15(18-4)16(12)20-9/h7-8,17H,5-6H2,1-4H3.
What are the key properties of 2-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-N-methylethanamine?
2-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-N-methylethanamine has a molecular weight of 273.33 g/mol, XLogP of 3.57, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxy-2,6-dimethylfuro[2,3-f][1]benzofuran-8-yl)-N-methylethanamine is sourced from PubChem (CID 117435826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).