C15H19N3O2 — CID 117436119
4-[4-(pyrrolidin-2-ylmethyl)phenyl]piperazine-2,6-dione (PubChem CID 117436119) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-[4-(pyrrolidin-2-ylmethyl)phenyl]piperazine-2,6-dione.
| Compound Name | 4-[4-(pyrrolidin-2-ylmethyl)phenyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 117436119 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 4-[4-(pyrrolidin-2-ylmethyl)phenyl]piperazine-2,6-dione |
| SMILES | O=C1CN(c2ccc(CC3CCCN3)cc2)CC(=O)N1 |
| InChI | InChI=1S/C15H19N3O2/c19-14-9-18(10-15(20)17-14)13-5-3-11(4-6-13)8-12-2-1-7-16-12/h3-6,12,16H,1-2,7-10H2,(H,17,19,20) |
| InChIKey | GCNNPWBGXCEGEX-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|