C15H19N3O2 — CID 117436130
4-[4-(2-morpholin-4-ylethyl)phenyl]-1,2-oxazol-5-amine (PubChem CID 117436130) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-[4-(2-morpholin-4-ylethyl)phenyl]-1,2-oxazol-5-amine.
| Compound Name | 4-[4-(2-morpholin-4-ylethyl)phenyl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117436130 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 4-[4-(2-morpholin-4-ylethyl)phenyl]-1,2-oxazol-5-amine |
| SMILES | Nc1oncc1-c1ccc(CCN2CCOCC2)cc1 |
| InChI | InChI=1S/C15H19N3O2/c16-15-14(11-17-20-15)13-3-1-12(2-4-13)5-6-18-7-9-19-10-8-18/h1-4,11H,5-10,16H2 |
| InChIKey | AJUIIIISQROILH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |