About 2-[2-(3,4-dichlorophenyl)ethyl-propylamino]-1-pyridin-3-ylethanol;hydrobromide
2-[2-(3,4-dichlorophenyl)ethyl-propylamino]-1-pyridin-3-ylethanol;hydrobromide (PubChem CID 11743621) has the molecular formula C18H23BrCl2N2O
and a molecular weight of 434.21 g/mol. Its IUPAC name is 2-[2-(3,4-dichlorophenyl)ethyl-propylamino]-1-pyridin-3-ylethanol;hydrobromide.
Molecular Properties
| Compound Name | 2-[2-(3,4-dichlorophenyl)ethyl-propylamino]-1-pyridin-3-ylethanol;hydrobromide |
| PubChem CID | 11743621 |
| Molecular Formula | C18H23BrCl2N2O |
| Molecular Weight | 434.21 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | 2-[2-(3,4-dichlorophenyl)ethyl-propylamino]-1-pyridin-3-ylethanol;hydrobromide |
| SMILES | Br.CCCN(CCc1ccc(Cl)c(Cl)c1)CC(O)c1cccnc1 |
| InChI | InChI=1S/C18H22Cl2N2O.BrH/c1-2-9-22(13-18(23)15-4-3-8-21-12-15)10-7-14-5-6-16(19)17(20)11-14;/h3-6,8,11-12,18,23H,2,7,9-10,13H2,1H3;1H |
| InChIKey | ANXHFAIJCYGDMI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.21 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(3,4-dichlorophenyl)ethyl-propylamino]-1-pyridin-3-ylethanol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,4-dichlorophenyl)ethyl-propylamino]-1-pyridin-3-ylethanol;hydrobromide?
The IUPAC name of 2-[2-(3,4-dichlorophenyl)ethyl-propylamino]-1-pyridin-3-ylethanol;hydrobromide (CID 11743621) is 2-[2-(3,4-dichlorophenyl)ethyl-propylamino]-1-pyridin-3-ylethanol;hydrobromide.
What is the SMILES notation for 2-[2-(3,4-dichlorophenyl)ethyl-propylamino]-1-pyridin-3-ylethanol;hydrobromide?
The canonical SMILES for 2-[2-(3,4-dichlorophenyl)ethyl-propylamino]-1-pyridin-3-ylethanol;hydrobromide is Br.CCCN(CCc1ccc(Cl)c(Cl)c1)CC(O)c1cccnc1.
What is the InChIKey of 2-[2-(3,4-dichlorophenyl)ethyl-propylamino]-1-pyridin-3-ylethanol;hydrobromide?
The InChIKey is ANXHFAIJCYGDMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22Cl2N2O.BrH/c1-2-9-22(13-18(23)15-4-3-8-21-12-15)10-7-14-5-6-16(19)17(20)11-14;/h3-6,8,11-12,18,23H,2,7,9-10,13H2,1H3;1H.
What are the key properties of 2-[2-(3,4-dichlorophenyl)ethyl-propylamino]-1-pyridin-3-ylethanol;hydrobromide?
2-[2-(3,4-dichlorophenyl)ethyl-propylamino]-1-pyridin-3-ylethanol;hydrobromide has a molecular weight of 434.21 g/mol, XLogP of 4.95, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,4-dichlorophenyl)ethyl-propylamino]-1-pyridin-3-ylethanol;hydrobromide is sourced from PubChem (CID 11743621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).