About 2-[3,4,5-tris(methylsulfanyl)phenyl]propan-1-amine
2-[3,4,5-tris(methylsulfanyl)phenyl]propan-1-amine (PubChem CID 117436822) has the molecular formula C12H19NS3
and a molecular weight of 273.49 g/mol. Its IUPAC name is 2-[3,4,5-tris(methylsulfanyl)phenyl]propan-1-amine.
Molecular Properties
| Compound Name | 2-[3,4,5-tris(methylsulfanyl)phenyl]propan-1-amine |
| PubChem CID | 117436822 |
| Molecular Formula | C12H19NS3 |
| Molecular Weight | 273.49 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-[3,4,5-tris(methylsulfanyl)phenyl]propan-1-amine |
| SMILES | CSc1cc(C(C)CN)cc(SC)c1SC |
| InChI | InChI=1S/C12H19NS3/c1-8(7-13)9-5-10(14-2)12(16-4)11(6-9)15-3/h5-6,8H,7,13H2,1-4H3 |
| InChIKey | WLQMKKZYRYZITI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3,4,5-tris(methylsulfanyl)phenyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,4,5-tris(methylsulfanyl)phenyl]propan-1-amine?
The IUPAC name of 2-[3,4,5-tris(methylsulfanyl)phenyl]propan-1-amine (CID 117436822) is 2-[3,4,5-tris(methylsulfanyl)phenyl]propan-1-amine.
What is the SMILES notation for 2-[3,4,5-tris(methylsulfanyl)phenyl]propan-1-amine?
The canonical SMILES for 2-[3,4,5-tris(methylsulfanyl)phenyl]propan-1-amine is CSc1cc(C(C)CN)cc(SC)c1SC.
What is the InChIKey of 2-[3,4,5-tris(methylsulfanyl)phenyl]propan-1-amine?
The InChIKey is WLQMKKZYRYZITI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NS3/c1-8(7-13)9-5-10(14-2)12(16-4)11(6-9)15-3/h5-6,8H,7,13H2,1-4H3.
What are the key properties of 2-[3,4,5-tris(methylsulfanyl)phenyl]propan-1-amine?
2-[3,4,5-tris(methylsulfanyl)phenyl]propan-1-amine has a molecular weight of 273.49 g/mol, XLogP of 3.91, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,4,5-tris(methylsulfanyl)phenyl]propan-1-amine is sourced from PubChem (CID 117436822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).