C17H25NO10S — CID 11743685
[(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-(ethoxycarbothioylamino)oxan-2-yl]methyl acetate (PubChem CID 11743685) has the molecular formula C17H25NO10S and a molecular weight of 435.45 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-(ethoxycarbothioylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-(ethoxycarbothioylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11743685 |
| Molecular Formula | C17H25NO10S |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-3,4,6-triacetyloxy-5-(ethoxycarbothioylamino)oxan-2-yl]methyl acetate |
| SMILES | CCOC(=S)N[C@H]1[C@@H](OC(C)=O)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H25NO10S/c1-6-23-17(29)18-13-15(26-10(4)21)14(25-9(3)20)12(7-24-8(2)19)28-16(13)27-11(5)22/h12-16H,6-7H2,1-5H3,(H,18,29)/t12-,13-,14-,15-,16+/m1/s1 |
| InChIKey | QKYGJXVRNBBFIQ-QCODTGAPSA-N |
| XLogP | -0.02 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|