C13H17ClFNO2 — CID 117437129
2-[(5-chloro-4-fluoro-2,3-dimethoxyphenyl)methyl]pyrrolidine (PubChem CID 117437129) has the molecular formula C13H17ClFNO2 and a molecular weight of 273.73 g/mol. Its IUPAC name is 2-[(5-chloro-4-fluoro-2,3-dimethoxyphenyl)methyl]pyrrolidine.
| Compound Name | 2-[(5-chloro-4-fluoro-2,3-dimethoxyphenyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 117437129 |
| Molecular Formula | C13H17ClFNO2 |
| Molecular Weight | 273.73 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-[(5-chloro-4-fluoro-2,3-dimethoxyphenyl)methyl]pyrrolidine |
| SMILES | COc1c(CC2CCCN2)cc(Cl)c(F)c1OC |
| InChI | InChI=1S/C13H17ClFNO2/c1-17-12-8(6-9-4-3-5-16-9)7-10(14)11(15)13(12)18-2/h7,9,16H,3-6H2,1-2H3 |
| InChIKey | LWGZYGPJSXZNSY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.73 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |