C11H13BrFNO — CID 117437506
1-[(3-bromo-5-fluoro-4-methoxyphenyl)methyl]cyclopropan-1-amine (PubChem CID 117437506) has the molecular formula C11H13BrFNO and a molecular weight of 274.13 g/mol. Its IUPAC name is 1-[(3-bromo-5-fluoro-4-methoxyphenyl)methyl]cyclopropan-1-amine.
| Compound Name | 1-[(3-bromo-5-fluoro-4-methoxyphenyl)methyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 117437506 |
| Molecular Formula | C11H13BrFNO |
| Molecular Weight | 274.13 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 1-[(3-bromo-5-fluoro-4-methoxyphenyl)methyl]cyclopropan-1-amine |
| SMILES | COc1c(F)cc(CC2(N)CC2)cc1Br |
| InChI | InChI=1S/C11H13BrFNO/c1-15-10-8(12)4-7(5-9(10)13)6-11(14)2-3-11/h4-5H,2-3,6,14H2,1H3 |
| InChIKey | RCEZNRJWSZPECJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.13 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |