C23H27N5O4 — CID 11743796
[4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl] bicyclo[2.2.2]octa-2,5-diene-1-carboxylate (PubChem CID 11743796) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl] bicyclo[2.2.2]octa-2,5-diene-1-carboxylate.
| Compound Name | [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl] bicyclo[2.2.2]octa-2,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 11743796 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | [4-(4-amino-6,7-dimethoxyquinazolin-2-yl)piperazin-1-yl] bicyclo[2.2.2]octa-2,5-diene-1-carboxylate |
| SMILES | COc1cc2nc(N3CCN(OC(=O)C45C=CC(C=C4)CC5)CC3)nc(N)c2cc1OC |
| InChI | InChI=1S/C23H27N5O4/c1-30-18-13-16-17(14-19(18)31-2)25-22(26-20(16)24)27-9-11-28(12-10-27)32-21(29)23-6-3-15(4-7-23)5-8-23/h3-4,6-7,13-15H,5,8-12H2,1-2H3,(H2,24,25,26) |
| InChIKey | LUKSTCFKVOFPJU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|