C17H22O3 — CID 117438576
1-(2-cyclopentyloxy-6-methylphenyl)cyclobutane-1-carboxylic acid (PubChem CID 117438576) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-(2-cyclopentyloxy-6-methylphenyl)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(2-cyclopentyloxy-6-methylphenyl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 117438576 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 1-(2-cyclopentyloxy-6-methylphenyl)cyclobutane-1-carboxylic acid |
| SMILES | Cc1cccc(OC2CCCC2)c1C1(C(=O)O)CCC1 |
| InChI | InChI=1S/C17H22O3/c1-12-6-4-9-14(20-13-7-2-3-8-13)15(12)17(16(18)19)10-5-11-17/h4,6,9,13H,2-3,5,7-8,10-11H2,1H3,(H,18,19) |
| InChIKey | MKAXZEDMGFJQDT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |