C24H28N2O2S2 — CID 11743980
5-[[4-methoxy-3-(7-methyl-1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)phenyl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 11743980) has the molecular formula C24H28N2O2S2 and a molecular weight of 440.63 g/mol. Its IUPAC name is 5-[[4-methoxy-3-(7-methyl-1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)phenyl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-methoxy-3-(7-methyl-1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)phenyl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 11743980 |
| Molecular Formula | C24H28N2O2S2 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 5-[[4-methoxy-3-(7-methyl-1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)phenyl]methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(CC2SC(=S)NC2=O)cc1-c1cc2c(cc1C)N(C(C)C)CCC2 |
| InChI | InChI=1S/C24H28N2O2S2/c1-14(2)26-9-5-6-17-13-18(15(3)10-20(17)26)19-11-16(7-8-21(19)28-4)12-22-23(27)25-24(29)30-22/h7-8,10-11,13-14,22H,5-6,9,12H2,1-4H3,(H,25,27,29) |
| InChIKey | ZPYKPGOICNHOKY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|