C23H23NO6S — CID 11744022
[3-acetyloxy-5-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]phenyl] acetate (PubChem CID 11744022) has the molecular formula C23H23NO6S and a molecular weight of 441.51 g/mol. Its IUPAC name is [3-acetyloxy-5-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]phenyl] acetate.
| Compound Name | [3-acetyloxy-5-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]phenyl] acetate |
|---|---|
| PubChem CID | 11744022 |
| Molecular Formula | C23H23NO6S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | [3-acetyloxy-5-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]phenyl] acetate |
| SMILES | CCOc1ccc(-c2nc(-c3cc(OC(C)=O)cc(OC(C)=O)c3)cs2)cc1OCC |
| InChI | InChI=1S/C23H23NO6S/c1-5-27-21-8-7-16(11-22(21)28-6-2)23-24-20(13-31-23)17-9-18(29-14(3)25)12-19(10-17)30-15(4)26/h7-13H,5-6H2,1-4H3 |
| InChIKey | XYDLOEPMHHLMTD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 83.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|