C17H20BrN3O4S — CID 11744049
ethyl 2-[3-[2-(4-acetamidophenyl)-2-oxoethyl]-2-amino-1,3-thiazol-3-ium-4-yl]acetate bromide (PubChem CID 11744049) has the molecular formula C17H20BrN3O4S and a molecular weight of 442.34 g/mol. Its IUPAC name is ethyl 2-[3-[2-(4-acetamidophenyl)-2-oxoethyl]-2-amino-1,3-thiazol-3-ium-4-yl]acetate bromide.
| Compound Name | ethyl 2-[3-[2-(4-acetamidophenyl)-2-oxoethyl]-2-amino-1,3-thiazol-3-ium-4-yl]acetate bromide |
|---|---|
| PubChem CID | 11744049 |
| Molecular Formula | C17H20BrN3O4S |
| Molecular Weight | 442.34 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | ethyl 2-[3-[2-(4-acetamidophenyl)-2-oxoethyl]-2-amino-1,3-thiazol-3-ium-4-yl]acetate bromide |
| SMILES | CCOC(=O)Cc1csc(N)[n+]1CC(=O)c1ccc(NC(C)=O)cc1.[Br-] |
| InChI | InChI=1S/C17H19N3O4S.BrH/c1-3-24-16(23)8-14-10-25-17(18)20(14)9-15(22)12-4-6-13(7-5-12)19-11(2)21;/h4-7,10,18H,3,8-9H2,1-2H3,(H,19,21,22);1H |
| InChIKey | XIRYGBVEEAFSFV-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.34 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|