C17H25NO2 — CID 117440762
3-(2,6,8-trimethyl-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-yl)butan-1-amine (PubChem CID 117440762) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 3-(2,6,8-trimethyl-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-yl)butan-1-amine.
| Compound Name | 3-(2,6,8-trimethyl-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-yl)butan-1-amine |
|---|---|
| PubChem CID | 117440762 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 3-(2,6,8-trimethyl-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran-4-yl)butan-1-amine |
| SMILES | Cc1c2c(c(C(C)CCN)c3c1OC(C)C3)OC(C)C2 |
| InChI | InChI=1S/C17H25NO2/c1-9(5-6-18)15-14-8-11(3)19-16(14)12(4)13-7-10(2)20-17(13)15/h9-11H,5-8,18H2,1-4H3 |
| InChIKey | AFYCOGTUGGCVGL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |