C11H12BrF2N — CID 117441728
1-[1-(2-bromo-3,5-difluorophenyl)cyclopropyl]ethanamine (PubChem CID 117441728) has the molecular formula C11H12BrF2N and a molecular weight of 276.12 g/mol. Its IUPAC name is 1-[1-(2-bromo-3,5-difluorophenyl)cyclopropyl]ethanamine.
| Compound Name | 1-[1-(2-bromo-3,5-difluorophenyl)cyclopropyl]ethanamine |
|---|---|
| PubChem CID | 117441728 |
| Molecular Formula | C11H12BrF2N |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 1-[1-(2-bromo-3,5-difluorophenyl)cyclopropyl]ethanamine |
| SMILES | CC(N)C1(c2cc(F)cc(F)c2Br)CC1 |
| InChI | InChI=1S/C11H12BrF2N/c1-6(15)11(2-3-11)8-4-7(13)5-9(14)10(8)12/h4-6H,2-3,15H2,1H3 |
| InChIKey | GFKAZOFKFFARSZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|