C26H24ClN3O2 — CID 11744258
[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-(6-methoxy-3-pyridinyl)methanone (PubChem CID 11744258) has the molecular formula C26H24ClN3O2 and a molecular weight of 445.95 g/mol. Its IUPAC name is [4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-(6-methoxy-3-pyridinyl)methanone.
| Compound Name | [4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-(6-methoxy-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 11744258 |
| Molecular Formula | C26H24ClN3O2 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | [4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-(6-methoxy-3-pyridinyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCC(=C3c4ccc(Cl)cc4CCc4cccnc43)CC2)cn1 |
| InChI | InChI=1S/C26H24ClN3O2/c1-32-23-9-6-20(16-29-23)26(31)30-13-10-17(11-14-30)24-22-8-7-21(27)15-19(22)5-4-18-3-2-12-28-25(18)24/h2-3,6-9,12,15-16H,4-5,10-11,13-14H2,1H3 |
| InChIKey | DUFKJULYEXQXBI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |