C26H24BrNO — CID 11744268
spiro[1,4-oxazinan-4-ium-4,13'-13-azoniapentacyclo[13.8.0.02,11.03,8.017,22]tricosa-1(23),2(11),3,5,7,9,15,17,19,21-decaene] bromide (PubChem CID 11744268) has the molecular formula C26H24BrNO and a molecular weight of 446.39 g/mol. Its IUPAC name is spiro[1,4-oxazinan-4-ium-4,13'-13-azoniapentacyclo[13.8.0.02,11.03,8.017,22]tricosa-1(23),2(11),3,5,7,9,15,17,19,21-decaene] bromide.
| Compound Name | spiro[1,4-oxazinan-4-ium-4,13'-13-azoniapentacyclo[13.8.0.02,11.03,8.017,22]tricosa-1(23),2(11),3,5,7,9,15,17,19,21-decaene] bromide |
|---|---|
| PubChem CID | 11744268 |
| Molecular Formula | C26H24BrNO |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | spiro[1,4-oxazinan-4-ium-4,13'-13-azoniapentacyclo[13.8.0.02,11.03,8.017,22]tricosa-1(23),2(11),3,5,7,9,15,17,19,21-decaene] bromide |
| SMILES | [Br-].c1ccc2cc3c(cc2c1)C[N+]1(CCOCC1)Cc1ccc2ccccc2c1-3 |
| InChI | InChI=1S/C26H24NO.BrH/c1-2-7-21-16-25-23(15-20(21)6-1)18-27(11-13-28-14-12-27)17-22-10-9-19-5-3-4-8-24(19)26(22)25;/h1-10,15-16H,11-14,17-18H2;1H/q+1;/p-1 |
| InChIKey | KFGUNCNSSGDOMC-UHFFFAOYSA-M |
| XLogP | 2.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|