C24H34BrNO2 — CID 11744378
[(1R,5S)-8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-phenylcyclohex-2-ene-1-carboxylate bromide (PubChem CID 11744378) has the molecular formula C24H34BrNO2 and a molecular weight of 448.45 g/mol. Its IUPAC name is [(1R,5S)-8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-phenylcyclohex-2-ene-1-carboxylate bromide.
| Compound Name | [(1R,5S)-8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-phenylcyclohex-2-ene-1-carboxylate bromide |
|---|---|
| PubChem CID | 11744378 |
| Molecular Formula | C24H34BrNO2 |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | [(1R,5S)-8-methyl-8-propan-2-yl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-phenylcyclohex-2-ene-1-carboxylate bromide |
| SMILES | CC(C)[N+]1(C)[C@@H]2CC[C@H]1CC(OC(=O)C1CCCC=C1c1ccccc1)C2.[Br-] |
| InChI | InChI=1S/C24H34NO2.BrH/c1-17(2)25(3)19-13-14-20(25)16-21(15-19)27-24(26)23-12-8-7-11-22(23)18-9-5-4-6-10-18;/h4-6,9-11,17,19-21,23H,7-8,12-16H2,1-3H3;1H/q+1;/p-1/t19-,20+,21?,23?,25?; |
| InChIKey | GFEAFVBEBHLXOF-AZOSIYQUSA-M |
| XLogP | 1.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|