C14H15NO5 — CID 117443882
5-[3-(1,2-dimethoxyethyl)phenyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 117443882) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is 5-[3-(1,2-dimethoxyethyl)phenyl]-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-[3-(1,2-dimethoxyethyl)phenyl]-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 117443882 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 5-[3-(1,2-dimethoxyethyl)phenyl]-1,2-oxazole-3-carboxylic acid |
| SMILES | COCC(OC)c1cccc(-c2cc(C(=O)O)no2)c1 |
| InChI | InChI=1S/C14H15NO5/c1-18-8-13(19-2)10-5-3-4-9(6-10)12-7-11(14(16)17)15-20-12/h3-7,13H,8H2,1-2H3,(H,16,17) |
| InChIKey | YCYJXCDJZDIXHD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |