C12H11N3O3S — CID 117444116
6-(5-amino-1-methylpyrazol-3-yl)-5-methoxy-1,3-benzoxathiol-2-one (PubChem CID 117444116) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is 6-(5-amino-1-methylpyrazol-3-yl)-5-methoxy-1,3-benzoxathiol-2-one.
| Compound Name | 6-(5-amino-1-methylpyrazol-3-yl)-5-methoxy-1,3-benzoxathiol-2-one |
|---|---|
| PubChem CID | 117444116 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 6-(5-amino-1-methylpyrazol-3-yl)-5-methoxy-1,3-benzoxathiol-2-one |
| SMILES | COc1cc2sc(=O)oc2cc1-c1cc(N)n(C)n1 |
| InChI | InChI=1S/C12H11N3O3S/c1-15-11(13)4-7(14-15)6-3-9-10(5-8(6)17-2)19-12(16)18-9/h3-5H,13H2,1-2H3 |
| InChIKey | PSTGTPQIDFXVRF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|