About 6-[2-(3-fluoroanilino)pyrimidin-4-yl]-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one
6-[2-(3-fluoroanilino)pyrimidin-4-yl]-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one (PubChem CID 11744429) has the molecular formula C24H24FN5O3
and a molecular weight of 449.49 g/mol. Its IUPAC name is 6-[2-(3-fluoroanilino)pyrimidin-4-yl]-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 6-[2-(3-fluoroanilino)pyrimidin-4-yl]-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one |
| PubChem CID | 11744429 |
| Molecular Formula | C24H24FN5O3 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 6-[2-(3-fluoroanilino)pyrimidin-4-yl]-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(-c3ccnc(Nc4cccc(F)c4)n3)cc2N1CCN1CCOCC1 |
| InChI | InChI=1S/C24H24FN5O3/c25-18-2-1-3-19(15-18)27-24-26-7-6-20(28-24)17-4-5-22-21(14-17)30(23(31)16-33-22)9-8-29-10-12-32-13-11-29/h1-7,14-15H,8-13,16H2,(H,26,27,28) |
| InChIKey | ONNRDAGCXZBNPQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-[2-(3-fluoroanilino)pyrimidin-4-yl]-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(3-fluoroanilino)pyrimidin-4-yl]-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one?
The IUPAC name of 6-[2-(3-fluoroanilino)pyrimidin-4-yl]-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one (CID 11744429) is 6-[2-(3-fluoroanilino)pyrimidin-4-yl]-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one.
What is the SMILES notation for 6-[2-(3-fluoroanilino)pyrimidin-4-yl]-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one?
The canonical SMILES for 6-[2-(3-fluoroanilino)pyrimidin-4-yl]-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one is O=C1COc2ccc(-c3ccnc(Nc4cccc(F)c4)n3)cc2N1CCN1CCOCC1.
What is the InChIKey of 6-[2-(3-fluoroanilino)pyrimidin-4-yl]-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one?
The InChIKey is ONNRDAGCXZBNPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24FN5O3/c25-18-2-1-3-19(15-18)27-24-26-7-6-20(28-24)17-4-5-22-21(14-17)30(23(31)16-33-22)9-8-29-10-12-32-13-11-29/h1-7,14-15H,8-13,16H2,(H,26,27,28).
What are the key properties of 6-[2-(3-fluoroanilino)pyrimidin-4-yl]-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one?
6-[2-(3-fluoroanilino)pyrimidin-4-yl]-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one has a molecular weight of 449.49 g/mol, XLogP of 3.08, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(3-fluoroanilino)pyrimidin-4-yl]-4-(2-morpholin-4-ylethyl)-1,4-benzoxazin-3-one is sourced from PubChem (CID 11744429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).