C21H40O6P2 — CID 11744476
[(8E,12E)-9,13,17-trimethyl-1-phosphonooctadeca-8,12,16-trienyl]phosphonic acid (PubChem CID 11744476) has the molecular formula C21H40O6P2 and a molecular weight of 450.49 g/mol. Its IUPAC name is [(8E,12E)-9,13,17-trimethyl-1-phosphonooctadeca-8,12,16-trienyl]phosphonic acid.
| Compound Name | [(8E,12E)-9,13,17-trimethyl-1-phosphonooctadeca-8,12,16-trienyl]phosphonic acid |
|---|---|
| PubChem CID | 11744476 |
| Molecular Formula | C21H40O6P2 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [(8E,12E)-9,13,17-trimethyl-1-phosphonooctadeca-8,12,16-trienyl]phosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCCCCCC(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C21H40O6P2/c1-18(2)12-10-14-20(4)16-11-15-19(3)13-8-6-5-7-9-17-21(28(22,23)24)29(25,26)27/h12-13,16,21H,5-11,14-15,17H2,1-4H3,(H2,22,23,24)(H2,25,26,27)/b19-13+,20-16+ |
| InChIKey | JZKYRYHDRAPIEL-ZMLAXJCCSA-N |
| XLogP | 6.43 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|