C17H27NO2 — CID 117444876
4-[(2,5-dimethoxy-4-propylphenyl)methyl]piperidine (PubChem CID 117444876) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 4-[(2,5-dimethoxy-4-propylphenyl)methyl]piperidine.
| Compound Name | 4-[(2,5-dimethoxy-4-propylphenyl)methyl]piperidine |
|---|---|
| PubChem CID | 117444876 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 4-[(2,5-dimethoxy-4-propylphenyl)methyl]piperidine |
| SMILES | CCCc1cc(OC)c(CC2CCNCC2)cc1OC |
| InChI | InChI=1S/C17H27NO2/c1-4-5-14-11-17(20-3)15(12-16(14)19-2)10-13-6-8-18-9-7-13/h11-13,18H,4-10H2,1-3H3 |
| InChIKey | NRQRJLXZCXIJGN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |