C14H10BrCl5O — CID 11744524
(1R,4S,5R)-5-(4-bromophenyl)-1,2,4,7,7-pentachloro-3-methoxybicyclo[2.2.1]hept-2-ene (PubChem CID 11744524) has the molecular formula C14H10BrCl5O and a molecular weight of 451.40 g/mol. Its IUPAC name is (1R,4S,5R)-5-(4-bromophenyl)-1,2,4,7,7-pentachloro-3-methoxybicyclo[2.2.1]hept-2-ene.
| Compound Name | (1R,4S,5R)-5-(4-bromophenyl)-1,2,4,7,7-pentachloro-3-methoxybicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 11744524 |
| Molecular Formula | C14H10BrCl5O |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 447.84 |
| IUPAC Name | (1R,4S,5R)-5-(4-bromophenyl)-1,2,4,7,7-pentachloro-3-methoxybicyclo[2.2.1]hept-2-ene |
| SMILES | COC1=C(Cl)[C@]2(Cl)C[C@H](c3ccc(Br)cc3)[C@@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C14H10BrCl5O/c1-21-11-10(16)12(17)6-9(13(11,18)14(12,19)20)7-2-4-8(15)5-3-7/h2-5,9H,6H2,1H3/t9-,12-,13+/m1/s1 |
| InChIKey | LIXIMXVQRNAGBV-WQAKAFBOSA-N |
| XLogP | 6.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|