About O-[2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)ethyl]hydroxylamine
O-[2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)ethyl]hydroxylamine (PubChem CID 117445396) has the molecular formula C9H9BrFNO3
and a molecular weight of 278.08 g/mol. Its IUPAC name is O-[2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)ethyl]hydroxylamine.
Molecular Properties
| Compound Name | O-[2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)ethyl]hydroxylamine |
| PubChem CID | 117445396 |
| Molecular Formula | C9H9BrFNO3 |
| Molecular Weight | 278.08 g/mol |
| Exact Mass | 276.97 |
| IUPAC Name | O-[2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)ethyl]hydroxylamine |
| SMILES | NOCCc1c(F)c(Br)cc2c1OCO2 |
| InChI | InChI=1S/C9H9BrFNO3/c10-6-3-7-9(14-4-13-7)5(8(6)11)1-2-15-12/h3H,1-2,4,12H2 |
| InChIKey | MBNUQWCFCFLUDD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.08 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)ethyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)ethyl]hydroxylamine?
The IUPAC name of O-[2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)ethyl]hydroxylamine (CID 117445396) is O-[2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)ethyl]hydroxylamine.
What is the SMILES notation for O-[2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)ethyl]hydroxylamine?
The canonical SMILES for O-[2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)ethyl]hydroxylamine is NOCCc1c(F)c(Br)cc2c1OCO2.
What is the InChIKey of O-[2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)ethyl]hydroxylamine?
The InChIKey is MBNUQWCFCFLUDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrFNO3/c10-6-3-7-9(14-4-13-7)5(8(6)11)1-2-15-12/h3H,1-2,4,12H2.
What are the key properties of O-[2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)ethyl]hydroxylamine?
O-[2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)ethyl]hydroxylamine has a molecular weight of 278.08 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-[2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)ethyl]hydroxylamine is sourced from PubChem (CID 117445396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).