2-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]propanoic acid

C12H13F3O4 — CID 117445688

IUPAC2-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]propanoic acid
SMILESCOc1cc(C(C)C(=O)O)c(C(F)(F)F)cc1OC
InChIInChI=1S/C12H13F3O4/c1-6(11(16)17)7-4-9(18-2)10(19-3)5-8(7)12(13,14)15/h4-6H,1-3H3,(H,16,17)
InChIKeyFPYVCBZUVIPNJU-UHFFFAOYSA-N
MW278.23 g/mol
LogP2.91
Rot. Bonds4

About 2-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]propanoic acid

2-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 117445688) has the molecular formula C12H13F3O4 and a molecular weight of 278.23 g/mol. Its IUPAC name is 2-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]propanoic acid.

Molecular Properties

Compound Name2-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]propanoic acid
PubChem CID117445688
Molecular FormulaC12H13F3O4
Molecular Weight278.23 g/mol
Exact Mass278.08
IUPAC Name2-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]propanoic acid
SMILESCOc1cc(C(C)C(=O)O)c(C(F)(F)F)cc1OC
InChIInChI=1S/C12H13F3O4/c1-6(11(16)17)7-4-9(18-2)10(19-3)5-8(7)12(13,14)15/h4-6H,1-3H3,(H,16,17)
InChIKeyFPYVCBZUVIPNJU-UHFFFAOYSA-N
XLogP2.91
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.23
LogP ≤ 52.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]propanoic acid?
The IUPAC name of 2-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]propanoic acid (CID 117445688) is 2-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]propanoic acid.
What is the SMILES notation for 2-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]propanoic acid?
The canonical SMILES for 2-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]propanoic acid is COc1cc(C(C)C(=O)O)c(C(F)(F)F)cc1OC.
What is the InChIKey of 2-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]propanoic acid?
The InChIKey is FPYVCBZUVIPNJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3O4/c1-6(11(16)17)7-4-9(18-2)10(19-3)5-8(7)12(13,14)15/h4-6H,1-3H3,(H,16,17).
What are the key properties of 2-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]propanoic acid?
2-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]propanoic acid has a molecular weight of 278.23 g/mol, XLogP of 2.91, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,5-dimethoxy-2-(trifluoromethyl)phenyl]propanoic acid is sourced from PubChem (CID 117445688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).