About 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide
4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 11744637) has the molecular formula C22H25F2NO5S
and a molecular weight of 453.51 g/mol. Its IUPAC name is 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
Molecular Properties
| Compound Name | 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| PubChem CID | 11744637 |
| Molecular Formula | C22H25F2NO5S |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(-c3ccc(CCCC(F)F)cc3)cc2)CCOCC1 |
| InChI | InChI=1S/C22H25F2NO5S/c23-20(24)3-1-2-16-4-6-17(7-5-16)18-8-10-19(11-9-18)31(28,29)22(21(26)25-27)12-14-30-15-13-22/h4-11,20,27H,1-3,12-15H2,(H,25,26) |
| InChIKey | CRWYSLGEHRJZHE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide?
The IUPAC name of 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (CID 11744637) is 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
What is the SMILES notation for 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide?
The canonical SMILES for 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide is O=C(NO)C1(S(=O)(=O)c2ccc(-c3ccc(CCCC(F)F)cc3)cc2)CCOCC1.
What is the InChIKey of 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide?
The InChIKey is CRWYSLGEHRJZHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25F2NO5S/c23-20(24)3-1-2-16-4-6-17(7-5-16)18-8-10-19(11-9-18)31(28,29)22(21(26)25-27)12-14-30-15-13-22/h4-11,20,27H,1-3,12-15H2,(H,25,26).
What are the key properties of 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide?
4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide has a molecular weight of 453.51 g/mol, XLogP of 3.77, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[4-(4,4-difluorobutyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide is sourced from PubChem (CID 11744637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).