C15H21NO4 — CID 117447910
3-amino-3-[2-methoxy-5-(oxan-4-yl)phenyl]propanoic acid (PubChem CID 117447910) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-amino-3-[2-methoxy-5-(oxan-4-yl)phenyl]propanoic acid.
| Compound Name | 3-amino-3-[2-methoxy-5-(oxan-4-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 117447910 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 3-amino-3-[2-methoxy-5-(oxan-4-yl)phenyl]propanoic acid |
| SMILES | COc1ccc(C2CCOCC2)cc1C(N)CC(=O)O |
| InChI | InChI=1S/C15H21NO4/c1-19-14-3-2-11(10-4-6-20-7-5-10)8-12(14)13(16)9-15(17)18/h2-3,8,10,13H,4-7,9,16H2,1H3,(H,17,18) |
| InChIKey | FDGVGLAAZFZQPK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |