About 5-ethyl-4-prop-2-enyl-3,6-dihydro-2H-pyran
5-ethyl-4-prop-2-enyl-3,6-dihydro-2H-pyran (PubChem CID 11744822) has the molecular formula C10H16O
and a molecular weight of 152.24 g/mol. Its IUPAC name is 5-ethyl-4-prop-2-enyl-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 5-ethyl-4-prop-2-enyl-3,6-dihydro-2H-pyran |
| PubChem CID | 11744822 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 5-ethyl-4-prop-2-enyl-3,6-dihydro-2H-pyran |
| SMILES | C=CCC1=C(CC)COCC1 |
| InChI | InChI=1S/C10H16O/c1-3-5-10-6-7-11-8-9(10)4-2/h3H,1,4-8H2,2H3 |
| InChIKey | VFSDXKVCZFVXDX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-4-prop-2-enyl-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4-prop-2-enyl-3,6-dihydro-2H-pyran?
The IUPAC name of 5-ethyl-4-prop-2-enyl-3,6-dihydro-2H-pyran (CID 11744822) is 5-ethyl-4-prop-2-enyl-3,6-dihydro-2H-pyran.
What is the SMILES notation for 5-ethyl-4-prop-2-enyl-3,6-dihydro-2H-pyran?
The canonical SMILES for 5-ethyl-4-prop-2-enyl-3,6-dihydro-2H-pyran is C=CCC1=C(CC)COCC1.
What is the InChIKey of 5-ethyl-4-prop-2-enyl-3,6-dihydro-2H-pyran?
The InChIKey is VFSDXKVCZFVXDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O/c1-3-5-10-6-7-11-8-9(10)4-2/h3H,1,4-8H2,2H3.
What are the key properties of 5-ethyl-4-prop-2-enyl-3,6-dihydro-2H-pyran?
5-ethyl-4-prop-2-enyl-3,6-dihydro-2H-pyran has a molecular weight of 152.24 g/mol, XLogP of 2.69, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4-prop-2-enyl-3,6-dihydro-2H-pyran is sourced from PubChem (CID 11744822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).