About ethyl (2E)-hepta-2,6-dienoate
ethyl (2E)-hepta-2,6-dienoate (PubChem CID 11744846) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is ethyl (2E)-hepta-2,6-dienoate.
Molecular Properties
| Compound Name | ethyl (2E)-hepta-2,6-dienoate |
| PubChem CID | 11744846 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | ethyl (2E)-hepta-2,6-dienoate |
| SMILES | C=CCC/C=C/C(=O)OCC |
| InChI | InChI=1S/C9H14O2/c1-3-5-6-7-8-9(10)11-4-2/h3,7-8H,1,4-6H2,2H3/b8-7+ |
| InChIKey | YXVOLAWZRLWSIQ-BQYQJAHWSA-N |
| XLogP | 2.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2E)-hepta-2,6-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2E)-hepta-2,6-dienoate?
The IUPAC name of ethyl (2E)-hepta-2,6-dienoate (CID 11744846) is ethyl (2E)-hepta-2,6-dienoate.
What is the SMILES notation for ethyl (2E)-hepta-2,6-dienoate?
The canonical SMILES for ethyl (2E)-hepta-2,6-dienoate is C=CCC/C=C/C(=O)OCC.
What is the InChIKey of ethyl (2E)-hepta-2,6-dienoate?
The InChIKey is YXVOLAWZRLWSIQ-BQYQJAHWSA-N. The full InChI is InChI=1S/C9H14O2/c1-3-5-6-7-8-9(10)11-4-2/h3,7-8H,1,4-6H2,2H3/b8-7+.
What are the key properties of ethyl (2E)-hepta-2,6-dienoate?
ethyl (2E)-hepta-2,6-dienoate has a molecular weight of 154.21 g/mol, XLogP of 2.07, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2E)-hepta-2,6-dienoate is sourced from PubChem (CID 11744846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).