About azulene-1-carbaldehyde
azulene-1-carbaldehyde (PubChem CID 11744870) has the molecular formula C11H8O
and a molecular weight of 156.18 g/mol. Its IUPAC name is azulene-1-carbaldehyde.
Molecular Properties
| Compound Name | azulene-1-carbaldehyde |
| PubChem CID | 11744870 |
| Molecular Formula | C11H8O |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | azulene-1-carbaldehyde |
| SMILES | O=Cc1ccc2cccccc1-2 |
| InChI | InChI=1S/C11H8O/c12-8-10-7-6-9-4-2-1-3-5-11(9)10/h1-8H |
| InChIKey | CZRXLQPVJOJLML-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze azulene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azulene-1-carbaldehyde?
The IUPAC name of azulene-1-carbaldehyde (CID 11744870) is azulene-1-carbaldehyde.
What is the SMILES notation for azulene-1-carbaldehyde?
The canonical SMILES for azulene-1-carbaldehyde is O=Cc1ccc2cccccc1-2.
What is the InChIKey of azulene-1-carbaldehyde?
The InChIKey is CZRXLQPVJOJLML-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O/c12-8-10-7-6-9-4-2-1-3-5-11(9)10/h1-8H.
What are the key properties of azulene-1-carbaldehyde?
azulene-1-carbaldehyde has a molecular weight of 156.18 g/mol, XLogP of 2.60, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azulene-1-carbaldehyde is sourced from PubChem (CID 11744870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).