C14H14ClNO3 — CID 117448718
7-chloro-5-(1-isocyanatocyclopentyl)-4-methyl-1,3-benzodioxole (PubChem CID 117448718) has the molecular formula C14H14ClNO3 and a molecular weight of 279.72 g/mol. Its IUPAC name is 7-chloro-5-(1-isocyanatocyclopentyl)-4-methyl-1,3-benzodioxole.
| Compound Name | 7-chloro-5-(1-isocyanatocyclopentyl)-4-methyl-1,3-benzodioxole |
|---|---|
| PubChem CID | 117448718 |
| Molecular Formula | C14H14ClNO3 |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 7-chloro-5-(1-isocyanatocyclopentyl)-4-methyl-1,3-benzodioxole |
| SMILES | Cc1c(C2(N=C=O)CCCC2)cc(Cl)c2c1OCO2 |
| InChI | InChI=1S/C14H14ClNO3/c1-9-10(14(16-7-17)4-2-3-5-14)6-11(15)13-12(9)18-8-19-13/h6H,2-5,8H2,1H3 |
| InChIKey | UPYPRQRRQZGIJV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|